C27H26N2O5 — CID 165343448
5-[[4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoyl]amino]pentanoic acid (PubChem CID 165343448) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is 5-[[4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoyl]amino]pentanoic acid.
| Compound Name | 5-[[4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 165343448 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 5-[[4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoyl]amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)c1ccc(NC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C27H26N2O5/c30-25(31)11-5-6-16-28-26(32)18-12-14-19(15-13-18)29-27(33)34-17-24-22-9-3-1-7-20(22)21-8-2-4-10-23(21)24/h1-4,7-10,12-15,24H,5-6,11,16-17H2,(H,28,32)(H,29,33)(H,30,31) |
| InChIKey | CDJMFGBDVWIBLL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|