C21H16ClNO2 — CID 12841540
9H-fluoren-9-ylmethyl N-(4-chlorophenyl)carbamate (PubChem CID 12841540) has the molecular formula C21H16ClNO2 and a molecular weight of 349.82 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(4-chlorophenyl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 12841540 |
| Molecular Formula | C21H16ClNO2 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(4-chlorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Cl)cc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H16ClNO2/c22-14-9-11-15(12-10-14)23-21(24)25-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-12,20H,13H2,(H,23,24) |
| InChIKey | ZQDRLJHNKXQDLG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |