C21H16ClNO5S — CID 87330347
5-chloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzenesulfonic acid (PubChem CID 87330347) has the molecular formula C21H16ClNO5S and a molecular weight of 429.88 g/mol. Its IUPAC name is 5-chloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzenesulfonic acid.
| Compound Name | 5-chloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 87330347 |
| Molecular Formula | C21H16ClNO5S |
| Molecular Weight | 429.88 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 5-chloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzenesulfonic acid |
| SMILES | O=C(Nc1ccc(Cl)cc1S(=O)(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H16ClNO5S/c22-13-9-10-19(20(11-13)29(25,26)27)23-21(24)28-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-11,18H,12H2,(H,23,24)(H,25,26,27) |
| InChIKey | OJOPJDJREFBDHK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.88 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|