C22H15Cl2NO4 — CID 63404936
3,5-dichloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (PubChem CID 63404936) has the molecular formula C22H15Cl2NO4 and a molecular weight of 428.27 g/mol. Its IUPAC name is 3,5-dichloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid.
| Compound Name | 3,5-dichloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
|---|---|
| PubChem CID | 63404936 |
| Molecular Formula | C22H15Cl2NO4 |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 3,5-dichloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
| SMILES | O=C(Nc1c(Cl)cc(Cl)cc1C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H15Cl2NO4/c23-12-9-17(21(26)27)20(19(24)10-12)25-22(28)29-11-18-15-7-3-1-5-13(15)14-6-2-4-8-16(14)18/h1-10,18H,11H2,(H,25,28)(H,26,27) |
| InChIKey | ANRHACHRZNKZHI-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |