C24H19ClN2O5 — CID 67019869
2-amino-3-chloro-4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]benzoic acid (PubChem CID 67019869) has the molecular formula C24H19ClN2O5 and a molecular weight of 450.88 g/mol. Its IUPAC name is 2-amino-3-chloro-4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]benzoic acid.
| Compound Name | 2-amino-3-chloro-4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]benzoic acid |
|---|---|
| PubChem CID | 67019869 |
| Molecular Formula | C24H19ClN2O5 |
| Molecular Weight | 450.88 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 2-amino-3-chloro-4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]benzoic acid |
| SMILES | Nc1c(C(=O)O)ccc(C(=O)CNC(=O)OCC2c3ccccc3-c3ccccc32)c1Cl |
| InChI | InChI=1S/C24H19ClN2O5/c25-21-17(9-10-18(22(21)26)23(29)30)20(28)11-27-24(31)32-12-19-15-7-3-1-5-13(15)14-6-2-4-8-16(14)19/h1-10,19H,11-12,26H2,(H,27,31)(H,29,30) |
| InChIKey | HUYCHGAWBIQEIP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.88 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|