C25H22N2O5 — CID 66966516
4-[[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-oxopropyl]amino]benzoic acid (PubChem CID 66966516) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is 4-[[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-oxopropyl]amino]benzoic acid.
| Compound Name | 4-[[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-oxopropyl]amino]benzoic acid |
|---|---|
| PubChem CID | 66966516 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 4-[[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-oxopropyl]amino]benzoic acid |
| SMILES | O=C(CNC(=O)OCC1c2ccccc2-c2ccccc21)CNc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H22N2O5/c28-18(13-26-17-11-9-16(10-12-17)24(29)30)14-27-25(31)32-15-23-21-7-3-1-5-19(21)20-6-2-4-8-22(20)23/h1-12,23,26H,13-15H2,(H,27,31)(H,29,30) |
| InChIKey | CHCPIILQIZRSPE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |