C22H23NO4 — CID 91976784
2-methylbut-3-en-2-yl 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate (PubChem CID 91976784) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-methylbut-3-en-2-yl 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate.
| Compound Name | 2-methylbut-3-en-2-yl 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 91976784 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 2-methylbut-3-en-2-yl 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate |
| SMILES | C=CC(C)(C)OC(=O)CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H23NO4/c1-4-22(2,3)27-20(24)13-23-21(25)26-14-19-17-11-7-5-9-15(17)16-10-6-8-12-18(16)19/h4-12,19H,1,13-14H2,2-3H3,(H,23,25) |
| InChIKey | XFPDIPBRRQHNRF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|