C47H56N4O8 — CID 161445836
9H-fluoren-9-ylmethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]acetate;9H-fluoren-9-ylmethyl 2-[3-(prop-2-enoxycarbonylamino)propylamino]acetate (PubChem CID 161445836) has the molecular formula C47H56N4O8 and a molecular weight of 804.98 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]acetate;9H-fluoren-9-ylmethyl 2-[3-(prop-2-enoxycarbonylamino)propylamino]acetate.
| Compound Name | 9H-fluoren-9-ylmethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]acetate;9H-fluoren-9-ylmethyl 2-[3-(prop-2-enoxycarbonylamino)propylamino]acetate |
|---|---|
| PubChem CID | 161445836 |
| Molecular Formula | C47H56N4O8 |
| Molecular Weight | 804.98 g/mol |
| Exact Mass | 804.41 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]acetate;9H-fluoren-9-ylmethyl 2-[3-(prop-2-enoxycarbonylamino)propylamino]acetate |
| SMILES | C=CCOC(=O)NCCCNCC(=O)OCC1c2ccccc2-c2ccccc21.CC(C)(C)OC(=O)NCCCNCC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H30N2O4.C23H26N2O4/c1-24(2,3)30-23(28)26-14-8-13-25-15-22(27)29-16-21-19-11-6-4-9-17(19)18-10-5-7-12-20(18)21;1-2-14-28-23(27)25-13-7-12-24-15-22(26)29-16-21-19-10-5-3-8-17(19)18-9-4-6-11-20(18)21/h4-7,9-12,21,25H,8,13-16H2,1-3H3,(H,26,28);2-6,8-11,21,24H,1,7,12-16H2,(H,25,27) |
| InChIKey | VZWLMNLHDTUKIT-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.98 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|