C24H32BrN3O5 — CID 135207393
9H-fluoren-9-ylmethyl N-(2-aminoethyl)carbamate;prop-2-enyl N-(3-hydroxypropyl)carbamate;hydrobromide (PubChem CID 135207393) has the molecular formula C24H32BrN3O5 and a molecular weight of 522.44 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(2-aminoethyl)carbamate;prop-2-enyl N-(3-hydroxypropyl)carbamate;hydrobromide.
| Compound Name | 9H-fluoren-9-ylmethyl N-(2-aminoethyl)carbamate;prop-2-enyl N-(3-hydroxypropyl)carbamate;hydrobromide |
|---|---|
| PubChem CID | 135207393 |
| Molecular Formula | C24H32BrN3O5 |
| Molecular Weight | 522.44 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(2-aminoethyl)carbamate;prop-2-enyl N-(3-hydroxypropyl)carbamate;hydrobromide |
| SMILES | Br.C=CCOC(=O)NCCCO.NCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C17H18N2O2.C7H13NO3.BrH/c18-9-10-19-17(20)21-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16;1-2-6-11-7(10)8-4-3-5-9;/h1-8,16H,9-11,18H2,(H,19,20);2,9H,1,3-6H2,(H,8,10);1H |
| InChIKey | HVXPGFVQGROJSZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|