C25H28N2O5 — CID 175773351
9H-fluoren-9-ylmethyl (3S)-3-amino-2-oxo-7-(prop-2-enoxycarbonylamino)heptanoate (PubChem CID 175773351) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (3S)-3-amino-2-oxo-7-(prop-2-enoxycarbonylamino)heptanoate.
| Compound Name | 9H-fluoren-9-ylmethyl (3S)-3-amino-2-oxo-7-(prop-2-enoxycarbonylamino)heptanoate |
|---|---|
| PubChem CID | 175773351 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (3S)-3-amino-2-oxo-7-(prop-2-enoxycarbonylamino)heptanoate |
| SMILES | C=CCOC(=O)NCCCC[C@H](N)C(=O)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H28N2O5/c1-2-15-31-25(30)27-14-8-7-13-22(26)23(28)24(29)32-16-21-19-11-5-3-9-17(19)18-10-4-6-12-20(18)21/h2-6,9-12,21-22H,1,7-8,13-16,26H2,(H,27,30)/t22-/m0/s1 |
| InChIKey | UTPOEELCSASJCT-QFIPXVFZSA-N |
| XLogP | 3.32 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|