C27H34N2O4 — CID 151918287
cyclohexyl (2S)-2-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate (PubChem CID 151918287) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is cyclohexyl (2S)-2-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate.
| Compound Name | cyclohexyl (2S)-2-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 151918287 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | cyclohexyl (2S)-2-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
| SMILES | N[C@@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C27H34N2O4/c28-25(26(30)33-19-10-2-1-3-11-19)16-8-9-17-29-27(31)32-18-24-22-14-6-4-12-20(22)21-13-5-7-15-23(21)24/h4-7,12-15,19,24-25H,1-3,8-11,16-18,28H2,(H,29,31)/t25-/m0/s1 |
| InChIKey | SWFKHPJXIUXVIL-VWLOTQADSA-N |
| XLogP | 4.90 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|