C19H13IN2O4S — CID 166000513
4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-iodo-1,2-thiazole-3-carboxylic acid (PubChem CID 166000513) has the molecular formula C19H13IN2O4S and a molecular weight of 492.29 g/mol. Its IUPAC name is 4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-iodo-1,2-thiazole-3-carboxylic acid.
| Compound Name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-iodo-1,2-thiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 166000513 |
| Molecular Formula | C19H13IN2O4S |
| Molecular Weight | 492.29 g/mol |
| Exact Mass | 491.96 |
| IUPAC Name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-iodo-1,2-thiazole-3-carboxylic acid |
| SMILES | O=C(Nc1c(C(=O)O)nsc1I)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H13IN2O4S/c20-17-15(16(18(23)24)22-27-17)21-19(25)26-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9H2,(H,21,25)(H,23,24) |
| InChIKey | FMWWDGVHMQIDIO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.29 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|