C23H21N3O4 — CID 142685185
4-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-(methylamino)benzoic acid (PubChem CID 142685185) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 4-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-(methylamino)benzoic acid.
| Compound Name | 4-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-(methylamino)benzoic acid |
|---|---|
| PubChem CID | 142685185 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 4-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-(methylamino)benzoic acid |
| SMILES | CNc1cc(C(=O)O)c(NC(=O)OCC2c3ccccc3-c3ccccc32)cc1N |
| InChI | InChI=1S/C23H21N3O4/c1-25-21-10-17(22(27)28)20(11-19(21)24)26-23(29)30-12-18-15-8-4-2-6-13(15)14-7-3-5-9-16(14)18/h2-11,18,25H,12,24H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | BUZDHSSVZZUBRS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|