C23H19NO4 — CID 56923983
2-(9H-fluoren-9-ylmethoxycarbonyl)-4-(methylamino)benzoic acid (PubChem CID 56923983) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonyl)-4-(methylamino)benzoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonyl)-4-(methylamino)benzoic acid |
|---|---|
| PubChem CID | 56923983 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonyl)-4-(methylamino)benzoic acid |
| SMILES | CNc1ccc(C(=O)O)c(C(=O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C23H19NO4/c1-24-14-10-11-19(22(25)26)20(12-14)23(27)28-13-21-17-8-4-2-6-15(17)16-7-3-5-9-18(16)21/h2-12,21,24H,13H2,1H3,(H,25,26) |
| InChIKey | ZIBGUADVFAGOLW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |