C24H21NO6 — CID 56923969
2-amino-3-(9H-fluoren-9-ylmethoxycarbonyl)-4,5-dimethoxybenzoic acid (PubChem CID 56923969) has the molecular formula C24H21NO6 and a molecular weight of 419.43 g/mol. Its IUPAC name is 2-amino-3-(9H-fluoren-9-ylmethoxycarbonyl)-4,5-dimethoxybenzoic acid.
| Compound Name | 2-amino-3-(9H-fluoren-9-ylmethoxycarbonyl)-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 56923969 |
| Molecular Formula | C24H21NO6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 2-amino-3-(9H-fluoren-9-ylmethoxycarbonyl)-4,5-dimethoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)c(N)c(C(=O)OCC2c3ccccc3-c3ccccc32)c1OC |
| InChI | InChI=1S/C24H21NO6/c1-29-19-11-17(23(26)27)21(25)20(22(19)30-2)24(28)31-12-18-15-9-5-3-7-13(15)14-8-4-6-10-16(14)18/h3-11,18H,12,25H2,1-2H3,(H,26,27) |
| InChIKey | CBEMWMPQICXZAA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|