C24H23NO2 — CID 143777566
9H-fluoren-9-ylmethyl N-(2,4,5-trimethylphenyl)carbamate (PubChem CID 143777566) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(2,4,5-trimethylphenyl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(2,4,5-trimethylphenyl)carbamate |
|---|---|
| PubChem CID | 143777566 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(2,4,5-trimethylphenyl)carbamate |
| SMILES | Cc1cc(C)c(NC(=O)OCC2c3ccccc3-c3ccccc32)cc1C |
| InChI | InChI=1S/C24H23NO2/c1-15-12-17(3)23(13-16(15)2)25-24(26)27-14-22-20-10-6-4-8-18(20)19-9-5-7-11-21(19)22/h4-13,22H,14H2,1-3H3,(H,25,26) |
| InChIKey | FZRGNYUUUZFWDU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |