C21H18N2O3 — CID 130987687
9H-fluoren-9-ylmethyl N-(5-amino-2-hydroxyphenyl)carbamate (PubChem CID 130987687) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(5-amino-2-hydroxyphenyl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(5-amino-2-hydroxyphenyl)carbamate |
|---|---|
| PubChem CID | 130987687 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(5-amino-2-hydroxyphenyl)carbamate |
| SMILES | Nc1ccc(O)c(NC(=O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C21H18N2O3/c22-13-9-10-20(24)19(11-13)23-21(25)26-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-11,18,24H,12,22H2,(H,23,25) |
| InChIKey | JQNJWSHVVGJLPK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|