C22H20N2O3 — CID 130985765
9H-fluoren-9-ylmethyl N-[3-amino-5-(hydroxymethyl)phenyl]carbamate (PubChem CID 130985765) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-amino-5-(hydroxymethyl)phenyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-amino-5-(hydroxymethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 130985765 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-amino-5-(hydroxymethyl)phenyl]carbamate |
| SMILES | Nc1cc(CO)cc(NC(=O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C22H20N2O3/c23-15-9-14(12-25)10-16(11-15)24-22(26)27-13-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-11,21,25H,12-13,23H2,(H,24,26) |
| InChIKey | VKWZIVUEHOIYQK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|