C21H16N2O4 — CID 14482307
9H-fluoren-9-ylmethyl N-(4-nitrophenyl)carbamate (PubChem CID 14482307) has the molecular formula C21H16N2O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(4-nitrophenyl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(4-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 14482307 |
| Molecular Formula | C21H16N2O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(4-nitrophenyl)carbamate |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H16N2O4/c24-21(22-14-9-11-15(12-10-14)23(25)26)27-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-12,20H,13H2,(H,22,24) |
| InChIKey | CUZAHPCOLQTEBR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|