C23H21N2O7P — CID 15339931
(9H-fluoren-9-ylmethoxycarbonylamino)methyl-[(4-nitrophenyl)methoxy]phosphinic acid (PubChem CID 15339931) has the molecular formula C23H21N2O7P and a molecular weight of 468.40 g/mol. Its IUPAC name is (9H-fluoren-9-ylmethoxycarbonylamino)methyl-[(4-nitrophenyl)methoxy]phosphinic acid.
| Compound Name | (9H-fluoren-9-ylmethoxycarbonylamino)methyl-[(4-nitrophenyl)methoxy]phosphinic acid |
|---|---|
| PubChem CID | 15339931 |
| Molecular Formula | C23H21N2O7P |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | (9H-fluoren-9-ylmethoxycarbonylamino)methyl-[(4-nitrophenyl)methoxy]phosphinic acid |
| SMILES | O=C(NCP(=O)(O)OCc1ccc([N+](=O)[O-])cc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H21N2O7P/c26-23(24-15-33(29,30)32-13-16-9-11-17(12-10-16)25(27)28)31-14-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-12,22H,13-15H2,(H,24,26)(H,29,30) |
| InChIKey | XGAQPBPNBLULAB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|