C25H24NO8P — CID 71011165
4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy-hydroxyphosphoryl]oxymethyl]benzoic acid (PubChem CID 71011165) has the molecular formula C25H24NO8P and a molecular weight of 497.44 g/mol. Its IUPAC name is 4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy-hydroxyphosphoryl]oxymethyl]benzoic acid.
| Compound Name | 4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy-hydroxyphosphoryl]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 71011165 |
| Molecular Formula | C25H24NO8P |
| Molecular Weight | 497.44 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy-hydroxyphosphoryl]oxymethyl]benzoic acid |
| SMILES | O=C(NCCOP(=O)(O)OCc1ccc(C(=O)O)cc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H24NO8P/c27-24(28)18-11-9-17(10-12-18)15-34-35(30,31)33-14-13-26-25(29)32-16-23-21-7-3-1-5-19(21)20-6-2-4-8-22(20)23/h1-12,23H,13-16H2,(H,26,29)(H,27,28)(H,30,31) |
| InChIKey | OHNRCBDCMBSFHY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|