C25H23ClN2O5 — CID 168638822
4-[(3-chloro-2-hydroxypropyl)amino]-3-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (PubChem CID 168638822) has the molecular formula C25H23ClN2O5 and a molecular weight of 466.92 g/mol. Its IUPAC name is 4-[(3-chloro-2-hydroxypropyl)amino]-3-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid.
| Compound Name | 4-[(3-chloro-2-hydroxypropyl)amino]-3-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
|---|---|
| PubChem CID | 168638822 |
| Molecular Formula | C25H23ClN2O5 |
| Molecular Weight | 466.92 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 4-[(3-chloro-2-hydroxypropyl)amino]-3-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
| SMILES | O=C(Nc1cc(C(=O)O)ccc1NCC(O)CCl)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H23ClN2O5/c26-12-16(29)13-27-22-10-9-15(24(30)31)11-23(22)28-25(32)33-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-11,16,21,27,29H,12-14H2,(H,28,32)(H,30,31) |
| InChIKey | QNFNAPBGYCLDIV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.92 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|