C10H11BrClNO3 — CID 168636294
3-bromo-4-[(3-chloro-2-hydroxypropyl)amino]benzoic acid (PubChem CID 168636294) has the molecular formula C10H11BrClNO3 and a molecular weight of 308.56 g/mol. Its IUPAC name is 3-bromo-4-[(3-chloro-2-hydroxypropyl)amino]benzoic acid.
| Compound Name | 3-bromo-4-[(3-chloro-2-hydroxypropyl)amino]benzoic acid |
|---|---|
| PubChem CID | 168636294 |
| Molecular Formula | C10H11BrClNO3 |
| Molecular Weight | 308.56 g/mol |
| Exact Mass | 306.96 |
| IUPAC Name | 3-bromo-4-[(3-chloro-2-hydroxypropyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NCC(O)CCl)c(Br)c1 |
| InChI | InChI=1S/C10H11BrClNO3/c11-8-3-6(10(15)16)1-2-9(8)13-5-7(14)4-12/h1-3,7,13-14H,4-5H2,(H,15,16) |
| InChIKey | PGAYSLKRQWVKTO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.56 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|