C37H32N2O4S2 — CID 129052269
[[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]-diphenylmethyl]sulfanyl (2R)-2-amino-3-sulfanylpropanoate (PubChem CID 129052269) has the molecular formula C37H32N2O4S2 and a molecular weight of 632.81 g/mol. Its IUPAC name is [[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]-diphenylmethyl]sulfanyl (2R)-2-amino-3-sulfanylpropanoate.
| Compound Name | [[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]-diphenylmethyl]sulfanyl (2R)-2-amino-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 129052269 |
| Molecular Formula | C37H32N2O4S2 |
| Molecular Weight | 632.81 g/mol |
| Exact Mass | 632.18 |
| IUPAC Name | [[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]-diphenylmethyl]sulfanyl (2R)-2-amino-3-sulfanylpropanoate |
| SMILES | N[C@@H](CS)C(=O)OSC(c1ccccc1)(c1ccccc1)c1ccc(NC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C37H32N2O4S2/c38-34(24-44)35(40)43-45-37(25-11-3-1-4-12-25,26-13-5-2-6-14-26)27-19-21-28(22-20-27)39-36(41)42-23-33-31-17-9-7-15-29(31)30-16-8-10-18-32(30)33/h1-22,33-34,44H,23-24,38H2,(H,39,41)/t34-/m0/s1 |
| InChIKey | VYZGCYXSUCNEJP-UMSFTDKQSA-N |
| XLogP | 7.79 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.81 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|