C38H33NO3S — CID 88927890
9H-fluoren-9-ylmethyl N-[(2R)-2-methyl-1-oxo-3-tritylsulfanylpropan-2-yl]carbamate (PubChem CID 88927890) has the molecular formula C38H33NO3S and a molecular weight of 583.75 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2R)-2-methyl-1-oxo-3-tritylsulfanylpropan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2R)-2-methyl-1-oxo-3-tritylsulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 88927890 |
| Molecular Formula | C38H33NO3S |
| Molecular Weight | 583.75 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2R)-2-methyl-1-oxo-3-tritylsulfanylpropan-2-yl]carbamate |
| SMILES | C[C@@](C=O)(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C38H33NO3S/c1-37(26-40,39-36(41)42-25-35-33-23-13-11-21-31(33)32-22-12-14-24-34(32)35)27-43-38(28-15-5-2-6-16-28,29-17-7-3-8-18-29)30-19-9-4-10-20-30/h2-24,26,35H,25,27H2,1H3,(H,39,41)/t37-/m1/s1 |
| InChIKey | IANCIBBYFAMQSR-DIPNUNPCSA-N |
| XLogP | 8.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.75 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|