C42H40N2O5S — CID 11571138
methyl (2R)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]-2-methyl-3-tritylsulfanylpropanoate (PubChem CID 11571138) has the molecular formula C42H40N2O5S and a molecular weight of 684.86 g/mol. Its IUPAC name is methyl (2R)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]-2-methyl-3-tritylsulfanylpropanoate.
| Compound Name | methyl (2R)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]-2-methyl-3-tritylsulfanylpropanoate |
|---|---|
| PubChem CID | 11571138 |
| Molecular Formula | C42H40N2O5S |
| Molecular Weight | 684.86 g/mol |
| Exact Mass | 684.27 |
| IUPAC Name | methyl (2R)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]-2-methyl-3-tritylsulfanylpropanoate |
| SMILES | COC(=O)[C@](C)(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)[C@H](C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C42H40N2O5S/c1-29(43-40(47)49-27-37-35-25-15-13-23-33(35)34-24-14-16-26-36(34)37)38(45)44-41(2,39(46)48-3)28-50-42(30-17-7-4-8-18-30,31-19-9-5-10-20-31)32-21-11-6-12-22-32/h4-26,29,37H,27-28H2,1-3H3,(H,43,47)(H,44,45)/t29-,41-/m0/s1 |
| InChIKey | XJEUMQMGXWTLPX-GJPBYDNQSA-N |
| XLogP | 7.69 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.86 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|