C64H62N2O3S2 — CID 127239930
9H-fluoren-9-ylmethyl N-[(2S)-1-[bis[2-[(4-methylphenyl)-diphenylmethyl]sulfanylethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 127239930) has the molecular formula C64H62N2O3S2 and a molecular weight of 971.35 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-1-[bis[2-[(4-methylphenyl)-diphenylmethyl]sulfanylethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[bis[2-[(4-methylphenyl)-diphenylmethyl]sulfanylethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 127239930 |
| Molecular Formula | C64H62N2O3S2 |
| Molecular Weight | 971.35 g/mol |
| Exact Mass | 970.42 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[bis[2-[(4-methylphenyl)-diphenylmethyl]sulfanylethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | Cc1ccc(C(SCCN(CCSC(c2ccccc2)(c2ccccc2)c2ccc(C)cc2)C(=O)[C@@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(C)C)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C64H62N2O3S2/c1-46(2)60(65-62(68)69-45-59-57-31-19-17-29-55(57)56-30-18-20-32-58(56)59)61(67)66(41-43-70-63(49-21-9-5-10-22-49,50-23-11-6-12-24-50)53-37-33-47(3)34-38-53)42-44-71-64(51-25-13-7-14-26-51,52-27-15-8-16-28-52)54-39-35-48(4)36-40-54/h5-40,46,59-60H,41-45H2,1-4H3,(H,65,68)/t60-/m0/s1 |
| InChIKey | QXBCZSLDAWLDFD-WDLSKMLESA-N |
| XLogP | 14.45 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 971.35 |
| LogP ≤ 5 | 14.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|