C45H44N2O5S — CID 11308603
prop-2-enyl (2R)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]-3-tritylsulfanylpropanoate (PubChem CID 11308603) has the molecular formula C45H44N2O5S and a molecular weight of 724.92 g/mol. Its IUPAC name is prop-2-enyl (2R)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]-3-tritylsulfanylpropanoate.
| Compound Name | prop-2-enyl (2R)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]-3-tritylsulfanylpropanoate |
|---|---|
| PubChem CID | 11308603 |
| Molecular Formula | C45H44N2O5S |
| Molecular Weight | 724.92 g/mol |
| Exact Mass | 724.30 |
| IUPAC Name | prop-2-enyl (2R)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]-3-tritylsulfanylpropanoate |
| SMILES | C=CCOC(=O)[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(C)C |
| InChI | InChI=1S/C45H44N2O5S/c1-4-28-51-43(49)40(30-53-45(32-18-8-5-9-19-32,33-20-10-6-11-21-33)34-22-12-7-13-23-34)46-42(48)41(31(2)3)47-44(50)52-29-39-37-26-16-14-24-35(37)36-25-15-17-27-38(36)39/h4-27,31,39-41H,1,28-30H2,2-3H3,(H,46,48)(H,47,50)/t40-,41+/m0/s1 |
| InChIKey | DOUQPSMGAQXQJX-WVILEFPPSA-N |
| XLogP | 8.49 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.92 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|