C50H48N2O6S — CID 59625103
(4-ethoxyphenyl)methyl (2R)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]amino]-3-tritylsulfanylpropanoate (PubChem CID 59625103) has the molecular formula C50H48N2O6S and a molecular weight of 805.01 g/mol. Its IUPAC name is (4-ethoxyphenyl)methyl (2R)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]amino]-3-tritylsulfanylpropanoate.
| Compound Name | (4-ethoxyphenyl)methyl (2R)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]amino]-3-tritylsulfanylpropanoate |
|---|---|
| PubChem CID | 59625103 |
| Molecular Formula | C50H48N2O6S |
| Molecular Weight | 805.01 g/mol |
| Exact Mass | 804.32 |
| IUPAC Name | (4-ethoxyphenyl)methyl (2R)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]amino]-3-tritylsulfanylpropanoate |
| SMILES | CCOc1ccc(COC(=O)[C@H](CSC(c2ccccc2)(c2ccccc2)c2ccccc2)NC(=O)[C@H](CC)NC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C50H48N2O6S/c1-3-45(52-49(55)58-33-44-42-26-16-14-24-40(42)41-25-15-17-27-43(41)44)47(53)51-46(48(54)57-32-35-28-30-39(31-29-35)56-4-2)34-59-50(36-18-8-5-9-19-36,37-20-10-6-11-21-37)38-22-12-7-13-23-38/h5-31,44-46H,3-4,32-34H2,1-2H3,(H,51,53)(H,52,55)/t45-,46-/m0/s1 |
| InChIKey | DMAPMFBQJVWFES-ZYBCLOSLSA-N |
| XLogP | 9.66 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.01 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|