C43H42N2O3S — CID 118626870
9H-fluoren-9-ylmethyl N-[(2R)-1-(cyclohexylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]carbamate (PubChem CID 118626870) has the molecular formula C43H42N2O3S and a molecular weight of 666.89 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2R)-1-(cyclohexylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2R)-1-(cyclohexylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 118626870 |
| Molecular Formula | C43H42N2O3S |
| Molecular Weight | 666.89 g/mol |
| Exact Mass | 666.29 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2R)-1-(cyclohexylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)NC1CCCCC1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C43H42N2O3S/c46-41(44-34-23-11-4-12-24-34)40(45-42(47)48-29-39-37-27-15-13-25-35(37)36-26-14-16-28-38(36)39)30-49-43(31-17-5-1-6-18-31,32-19-7-2-8-20-32)33-21-9-3-10-22-33/h1-3,5-10,13-22,25-28,34,39-40H,4,11-12,23-24,29-30H2,(H,44,46)(H,45,47)/t40-/m0/s1 |
| InChIKey | ZVRMTQLTHKEFRF-FAIXQHPJSA-N |
| XLogP | 9.07 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.89 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|