C41H40N2O6S2 — CID 87985260
(2R)-2-amino-2-methyl-3-sulfanylpropanoic acid;2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid (PubChem CID 87985260) has the molecular formula C41H40N2O6S2 and a molecular weight of 720.91 g/mol. Its IUPAC name is (2R)-2-amino-2-methyl-3-sulfanylpropanoic acid;2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-2-methyl-3-sulfanylpropanoic acid;2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 87985260 |
| Molecular Formula | C41H40N2O6S2 |
| Molecular Weight | 720.91 g/mol |
| Exact Mass | 720.23 |
| IUPAC Name | (2R)-2-amino-2-methyl-3-sulfanylpropanoic acid;2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid |
| SMILES | C[C@](N)(CS)C(=O)O.O=C(NC(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C37H31NO4S.C4H9NO2S/c39-35(40)34(38-36(41)42-24-33-31-22-12-10-20-29(31)30-21-11-13-23-32(30)33)25-43-37(26-14-4-1-5-15-26,27-16-6-2-7-17-27)28-18-8-3-9-19-28;1-4(5,2-8)3(6)7/h1-23,33-34H,24-25H2,(H,38,41)(H,39,40);8H,2,5H2,1H3,(H,6,7)/t;4-/m.0/s1 |
| InChIKey | RBPUUINVNWJASI-VWMHFEHESA-N |
| XLogP | 7.42 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.91 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|