C48H49NO7S — CID 162144693
8-O-tert-butyl 1-O-methyl 7-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-2-(tritylsulfanylmethyl)octanedioate (PubChem CID 162144693) has the molecular formula C48H49NO7S and a molecular weight of 783.99 g/mol. Its IUPAC name is 8-O-tert-butyl 1-O-methyl 7-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-2-(tritylsulfanylmethyl)octanedioate.
| Compound Name | 8-O-tert-butyl 1-O-methyl 7-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-2-(tritylsulfanylmethyl)octanedioate |
|---|---|
| PubChem CID | 162144693 |
| Molecular Formula | C48H49NO7S |
| Molecular Weight | 783.99 g/mol |
| Exact Mass | 783.32 |
| IUPAC Name | 8-O-tert-butyl 1-O-methyl 7-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-2-(tritylsulfanylmethyl)octanedioate |
| SMILES | COC(=O)C(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)CC(=O)CCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C48H49NO7S/c1-47(2,3)56-45(52)43(49-46(53)55-31-42-40-26-16-14-24-38(40)39-25-15-17-27-41(39)42)29-28-37(50)30-33(44(51)54-4)32-57-48(34-18-8-5-9-19-34,35-20-10-6-11-21-35)36-22-12-7-13-23-36/h5-27,33,42-43H,28-32H2,1-4H3,(H,49,53) |
| InChIKey | SGKTZJUUZLFNNV-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.99 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|