C46H48N2O5S — CID 167540455
tert-butyl N-[(5R)-5-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-6-tritylsulfanylhexyl]-N-methylcarbamate (PubChem CID 167540455) has the molecular formula C46H48N2O5S and a molecular weight of 740.97 g/mol. Its IUPAC name is tert-butyl N-[(5R)-5-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-6-tritylsulfanylhexyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(5R)-5-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-6-tritylsulfanylhexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 167540455 |
| Molecular Formula | C46H48N2O5S |
| Molecular Weight | 740.97 g/mol |
| Exact Mass | 740.33 |
| IUPAC Name | tert-butyl N-[(5R)-5-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-6-tritylsulfanylhexyl]-N-methylcarbamate |
| SMILES | CN(CCCC(=O)[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C46H48N2O5S/c1-45(2,3)53-44(51)48(4)30-18-29-42(49)41(47-43(50)52-31-40-38-27-16-14-25-36(38)37-26-15-17-28-39(37)40)32-54-46(33-19-8-5-9-20-33,34-21-10-6-11-22-34)35-23-12-7-13-24-35/h5-17,19-28,40-41H,18,29-32H2,1-4H3,(H,47,50)/t41-/m0/s1 |
| InChIKey | PPBRWNZXTNJPQI-RWYGWLOXSA-N |
| XLogP | 9.84 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.97 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|