C50H54N2O7 — CID 147154016
2-(9H-fluoren-9-ylmethoxycarbonylamino)-12-[(2-methylpropan-2-yl)oxy]-8,12-dioxo-11-(tritylamino)dodecanoic acid (PubChem CID 147154016) has the molecular formula C50H54N2O7 and a molecular weight of 794.99 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-12-[(2-methylpropan-2-yl)oxy]-8,12-dioxo-11-(tritylamino)dodecanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-12-[(2-methylpropan-2-yl)oxy]-8,12-dioxo-11-(tritylamino)dodecanoic acid |
|---|---|
| PubChem CID | 147154016 |
| Molecular Formula | C50H54N2O7 |
| Molecular Weight | 794.99 g/mol |
| Exact Mass | 794.39 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-12-[(2-methylpropan-2-yl)oxy]-8,12-dioxo-11-(tritylamino)dodecanoic acid |
| SMILES | CC(C)(C)OC(=O)C(CCC(=O)CCCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C50H54N2O7/c1-49(2,3)59-47(56)45(52-50(35-20-8-4-9-21-35,36-22-10-5-11-23-36)37-24-12-6-13-25-37)33-32-38(53)26-14-7-15-31-44(46(54)55)51-48(57)58-34-43-41-29-18-16-27-39(41)40-28-17-19-30-42(40)43/h4-6,8-13,16-25,27-30,43-45,52H,7,14-15,26,31-34H2,1-3H3,(H,51,57)(H,54,55) |
| InChIKey | BUNNKLJNJKJZJF-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.99 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|