C47H42N2O8 — CID 158087439
(2R,11S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-11-(hexadeca-2,4,6,8,10,12,14-heptaynoylamino)-12-[(2-methylpropan-2-yl)oxy]-8,12-dioxododecanoic acid (PubChem CID 158087439) has the molecular formula C47H42N2O8 and a molecular weight of 762.86 g/mol. Its IUPAC name is (2R,11S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-11-(hexadeca-2,4,6,8,10,12,14-heptaynoylamino)-12-[(2-methylpropan-2-yl)oxy]-8,12-dioxododecanoic acid.
| Compound Name | (2R,11S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-11-(hexadeca-2,4,6,8,10,12,14-heptaynoylamino)-12-[(2-methylpropan-2-yl)oxy]-8,12-dioxododecanoic acid |
|---|---|
| PubChem CID | 158087439 |
| Molecular Formula | C47H42N2O8 |
| Molecular Weight | 762.86 g/mol |
| Exact Mass | 762.29 |
| IUPAC Name | (2R,11S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-11-(hexadeca-2,4,6,8,10,12,14-heptaynoylamino)-12-[(2-methylpropan-2-yl)oxy]-8,12-dioxododecanoic acid |
| SMILES | CC#CC#CC#CC#CC#CC#CC#CC(=O)N[C@@H](CCC(=O)CCCCC[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C47H42N2O8/c1-5-6-7-8-9-10-11-12-13-14-15-16-20-31-43(51)48-42(45(54)57-47(2,3)4)33-32-35(50)25-18-17-19-30-41(44(52)53)49-46(55)56-34-40-38-28-23-21-26-36(38)37-27-22-24-29-39(37)40/h21-24,26-29,40-42H,17-19,25,30,32-34H2,1-4H3,(H,48,51)(H,49,55)(H,52,53)/t41-,42+/m1/s1 |
| InChIKey | IMQALWJNAIHWLN-HLFYWILQSA-N |
| XLogP | 5.15 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.86 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|