C50H46N2O8 — CID 158731507
1-O-tert-butyl 12-O-prop-2-enyl (2S,11S)-11-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(hexadeca-2,4,6,8,10,12,14-heptaynoylamino)-5-oxododecanedioate (PubChem CID 158731507) has the molecular formula C50H46N2O8 and a molecular weight of 802.92 g/mol. Its IUPAC name is 1-O-tert-butyl 12-O-prop-2-enyl (2S,11S)-11-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(hexadeca-2,4,6,8,10,12,14-heptaynoylamino)-5-oxododecanedioate.
| Compound Name | 1-O-tert-butyl 12-O-prop-2-enyl (2S,11S)-11-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(hexadeca-2,4,6,8,10,12,14-heptaynoylamino)-5-oxododecanedioate |
|---|---|
| PubChem CID | 158731507 |
| Molecular Formula | C50H46N2O8 |
| Molecular Weight | 802.92 g/mol |
| Exact Mass | 802.33 |
| IUPAC Name | 1-O-tert-butyl 12-O-prop-2-enyl (2S,11S)-11-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(hexadeca-2,4,6,8,10,12,14-heptaynoylamino)-5-oxododecanedioate |
| SMILES | C=CCOC(=O)[C@H](CCCCCC(=O)CC[C@H](NC(=O)C#CC#CC#CC#CC#CC#CC#CC)C(=O)OC(C)(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C50H46N2O8/c1-6-8-9-10-11-12-13-14-15-16-17-18-22-33-46(54)51-45(48(56)60-50(3,4)5)35-34-38(53)27-20-19-21-32-44(47(55)58-36-7-2)52-49(57)59-37-43-41-30-25-23-28-39(41)40-29-24-26-31-42(40)43/h7,23-26,28-31,43-45H,2,19-21,27,32,34-37H2,1,3-5H3,(H,51,54)(H,52,57)/t44-,45-/m0/s1 |
| InChIKey | LZCDKVPECQNDGO-GSVOJQHPSA-N |
| XLogP | 5.79 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.92 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|