C47H41N3O7S — CID 46842149
methyl (2S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]-3-(4-nitrophenyl)propanoate (PubChem CID 46842149) has the molecular formula C47H41N3O7S and a molecular weight of 791.93 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]-3-(4-nitrophenyl)propanoate.
| Compound Name | methyl (2S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]-3-(4-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 46842149 |
| Molecular Formula | C47H41N3O7S |
| Molecular Weight | 791.93 g/mol |
| Exact Mass | 791.27 |
| IUPAC Name | methyl (2S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]-3-(4-nitrophenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C47H41N3O7S/c1-56-45(52)42(29-32-25-27-36(28-26-32)50(54)55)48-44(51)43(49-46(53)57-30-41-39-23-13-11-21-37(39)38-22-12-14-24-40(38)41)31-58-47(33-15-5-2-6-16-33,34-17-7-3-8-18-34)35-19-9-4-10-20-35/h2-28,41-43H,29-31H2,1H3,(H,48,51)(H,49,53)/t42-,43-/m0/s1 |
| InChIKey | PFAJXAZGDJBMHS-MJPWBCPGSA-N |
| XLogP | 8.43 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.93 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|