C29H29N3O7 — CID 75218117
2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]-3-(4-nitrophenyl)propanoic acid (PubChem CID 75218117) has the molecular formula C29H29N3O7 and a molecular weight of 531.57 g/mol. Its IUPAC name is 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]-3-(4-nitrophenyl)propanoic acid.
| Compound Name | 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]-3-(4-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 75218117 |
| Molecular Formula | C29H29N3O7 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]-3-(4-nitrophenyl)propanoic acid |
| SMILES | CC(C)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC(Cc1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C29H29N3O7/c1-17(2)26(27(33)30-25(28(34)35)15-18-11-13-19(14-12-18)32(37)38)31-29(36)39-16-24-22-9-5-3-7-20(22)21-8-4-6-10-23(21)24/h3-14,17,24-26H,15-16H2,1-2H3,(H,30,33)(H,31,36)(H,34,35) |
| InChIKey | HFQFVQFIADRKFE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|