C35H41N5O8 — CID 175994966
(2S)-2-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 175994966) has the molecular formula C35H41N5O8 and a molecular weight of 659.74 g/mol. Its IUPAC name is (2S)-2-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 175994966 |
| Molecular Formula | C35H41N5O8 |
| Molecular Weight | 659.74 g/mol |
| Exact Mass | 659.30 |
| IUPAC Name | (2S)-2-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CC(C)[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N[C@@H](CCCNC(N)=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C35H41N5O8/c1-20(2)30(40-35(47)48-19-27-25-10-5-3-8-23(25)24-9-4-6-11-26(24)27)32(43)38-28(12-7-17-37-34(36)46)31(42)39-29(33(44)45)18-21-13-15-22(41)16-14-21/h3-6,8-11,13-16,20,27-30,41H,7,12,17-19H2,1-2H3,(H,38,43)(H,39,42)(H,40,47)(H,44,45)(H3,36,37,46)/t28-,29-,30-/m0/s1 |
| InChIKey | ILRMNARWUFWCOQ-DTXPUJKBSA-N |
| XLogP | 3.00 |
| TPSA | 209.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.74 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|