C35H47N5O8 — CID 175281206
2-amino-5-(carbamoylamino)pentanoic acid;1-(4-aminophenyl)propan-2-ol;2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid (PubChem CID 175281206) has the molecular formula C35H47N5O8 and a molecular weight of 665.79 g/mol. Its IUPAC name is 2-amino-5-(carbamoylamino)pentanoic acid;1-(4-aminophenyl)propan-2-ol;2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid.
| Compound Name | 2-amino-5-(carbamoylamino)pentanoic acid;1-(4-aminophenyl)propan-2-ol;2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 175281206 |
| Molecular Formula | C35H47N5O8 |
| Molecular Weight | 665.79 g/mol |
| Exact Mass | 665.34 |
| IUPAC Name | 2-amino-5-(carbamoylamino)pentanoic acid;1-(4-aminophenyl)propan-2-ol;2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O.CC(O)Cc1ccc(N)cc1.NC(=O)NCCCC(N)C(=O)O |
| InChI | InChI=1S/C20H21NO4.C9H13NO.C6H13N3O3/c1-12(2)18(19(22)23)21-20(24)25-11-17-15-9-5-3-7-13(15)14-8-4-6-10-16(14)17;1-7(11)6-8-2-4-9(10)5-3-8;7-4(5(10)11)2-1-3-9-6(8)12/h3-10,12,17-18H,11H2,1-2H3,(H,21,24)(H,22,23);2-5,7,11H,6,10H2,1H3;4H,1-3,7H2,(H,10,11)(H3,8,9,12) |
| InChIKey | ACQPYYCIZOINPH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 240.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.79 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|