C36H47N5O7 — CID 91147726
(2S)-2-amino-5-(methylamino)pentanoic acid;(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]-5-(methylamino)pentanoic acid (PubChem CID 91147726) has the molecular formula C36H47N5O7 and a molecular weight of 661.80 g/mol. Its IUPAC name is (2S)-2-amino-5-(methylamino)pentanoic acid;(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]-5-(methylamino)pentanoic acid.
| Compound Name | (2S)-2-amino-5-(methylamino)pentanoic acid;(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]-5-(methylamino)pentanoic acid |
|---|---|
| PubChem CID | 91147726 |
| Molecular Formula | C36H47N5O7 |
| Molecular Weight | 661.80 g/mol |
| Exact Mass | 661.35 |
| IUPAC Name | (2S)-2-amino-5-(methylamino)pentanoic acid;(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]-5-(methylamino)pentanoic acid |
| SMILES | CNCCC[C@H](N)C(=O)O.CNCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C30H33N3O5.C6H14N2O2/c1-31-17-9-16-26(29(35)36)32-28(34)27(18-20-10-3-2-4-11-20)33-30(37)38-19-25-23-14-7-5-12-21(23)22-13-6-8-15-24(22)25;1-8-4-2-3-5(7)6(9)10/h2-8,10-15,25-27,31H,9,16-19H2,1H3,(H,32,34)(H,33,37)(H,35,36);5,8H,2-4,7H2,1H3,(H,9,10)/t26-,27-;5-/m00/s1 |
| InChIKey | ISQYOENXVWITQO-SXLAGZRWSA-N |
| XLogP | 3.10 |
| TPSA | 192.11 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.80 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|