C30H33N3O4 — CID 58413675
9H-fluoren-9-ylmethyl N-[5-(methylamino)-1-oxo-1-[(2-oxo-1-phenylpropyl)amino]pentan-2-yl]carbamate (PubChem CID 58413675) has the molecular formula C30H33N3O4 and a molecular weight of 499.61 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[5-(methylamino)-1-oxo-1-[(2-oxo-1-phenylpropyl)amino]pentan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[5-(methylamino)-1-oxo-1-[(2-oxo-1-phenylpropyl)amino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 58413675 |
| Molecular Formula | C30H33N3O4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[5-(methylamino)-1-oxo-1-[(2-oxo-1-phenylpropyl)amino]pentan-2-yl]carbamate |
| SMILES | CNCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC(C(C)=O)c1ccccc1 |
| InChI | InChI=1S/C30H33N3O4/c1-20(34)28(21-11-4-3-5-12-21)33-29(35)27(17-10-18-31-2)32-30(36)37-19-26-24-15-8-6-13-22(24)23-14-7-9-16-25(23)26/h3-9,11-16,26-28,31H,10,17-19H2,1-2H3,(H,32,36)(H,33,35) |
| InChIKey | VPSQCBOYBMLNJM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|