C38H47N5O8 — CID 70792717
(4R)-5-[4-[[(2S)-5-(carbamoylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl]amino]phenyl]-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (PubChem CID 70792717) has the molecular formula C38H47N5O8 and a molecular weight of 701.82 g/mol. Its IUPAC name is (4R)-5-[4-[[(2S)-5-(carbamoylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl]amino]phenyl]-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid.
| Compound Name | (4R)-5-[4-[[(2S)-5-(carbamoylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl]amino]phenyl]-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 70792717 |
| Molecular Formula | C38H47N5O8 |
| Molecular Weight | 701.82 g/mol |
| Exact Mass | 701.34 |
| IUPAC Name | (4R)-5-[4-[[(2S)-5-(carbamoylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl]amino]phenyl]-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| SMILES | CC(C[C@H](Cc1ccc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)OCC2c3ccccc3-c3ccccc32)cc1)NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C38H47N5O8/c1-23(34(45)46)20-26(42-37(49)51-38(2,3)4)21-24-15-17-25(18-16-24)41-33(44)32(14-9-19-40-35(39)47)43-36(48)50-22-31-29-12-7-5-10-27(29)28-11-6-8-13-30(28)31/h5-8,10-13,15-18,23,26,31-32H,9,14,19-22H2,1-4H3,(H,41,44)(H,42,49)(H,43,48)(H,45,46)(H3,39,40,47)/t23?,26-,32+/m1/s1 |
| InChIKey | ZBCXFCZMSDTXDP-IPLZTGAQSA-N |
| XLogP | 5.53 |
| TPSA | 198.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.82 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|