C40H52N8O8 — CID 59365052
tert-butyl 4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-5-(carbamoylamino)-2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]pentanoyl]amino]pentanoyl]amino]benzoate (PubChem CID 59365052) has the molecular formula C40H52N8O8 and a molecular weight of 772.90 g/mol. Its IUPAC name is tert-butyl 4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-5-(carbamoylamino)-2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]pentanoyl]amino]pentanoyl]amino]benzoate.
| Compound Name | tert-butyl 4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-5-(carbamoylamino)-2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]pentanoyl]amino]pentanoyl]amino]benzoate |
|---|---|
| PubChem CID | 59365052 |
| Molecular Formula | C40H52N8O8 |
| Molecular Weight | 772.90 g/mol |
| Exact Mass | 772.39 |
| IUPAC Name | tert-butyl 4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-5-(carbamoylamino)-2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]pentanoyl]amino]pentanoyl]amino]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@H](CCCNC(N)=O)NCCNC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C40H52N8O8/c1-40(2,3)56-36(51)25-16-18-26(19-17-25)47-35(50)33(15-9-21-45-38(42)53)48-34(49)32(14-8-20-44-37(41)52)43-22-23-46-39(54)55-24-31-29-12-6-4-10-27(29)28-11-5-7-13-30(28)31/h4-7,10-13,16-19,31-33,43H,8-9,14-15,20-24H2,1-3H3,(H,46,54)(H,47,50)(H,48,49)(H3,41,44,52)(H3,42,45,53)/t32-,33-/m0/s1 |
| InChIKey | RSKVFWIBSKSBLY-LQJZCPKCSA-N |
| XLogP | 3.46 |
| TPSA | 245.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.90 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|