C24H40N6O5 — CID 125496426
tert-butyl 4-[[(2S)-2-[[(2S)-2-(2-aminoethylamino)-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]benzoate (PubChem CID 125496426) has the molecular formula C24H40N6O5 and a molecular weight of 492.62 g/mol. Its IUPAC name is tert-butyl 4-[[(2S)-2-[[(2S)-2-(2-aminoethylamino)-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]benzoate.
| Compound Name | tert-butyl 4-[[(2S)-2-[[(2S)-2-(2-aminoethylamino)-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]benzoate |
|---|---|
| PubChem CID | 125496426 |
| Molecular Formula | C24H40N6O5 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | tert-butyl 4-[[(2S)-2-[[(2S)-2-(2-aminoethylamino)-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]benzoate |
| SMILES | CC(C)[C@H](NCCN)C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H40N6O5/c1-15(2)19(27-14-12-25)21(32)30-18(7-6-13-28-23(26)34)20(31)29-17-10-8-16(9-11-17)22(33)35-24(3,4)5/h8-11,15,18-19,27H,6-7,12-14,25H2,1-5H3,(H,29,31)(H,30,32)(H3,26,28,34)/t18-,19-/m0/s1 |
| InChIKey | IYCHTORMPZLFQN-OALUTQOASA-N |
| XLogP | 1.09 |
| TPSA | 177.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|