C21H35N5O4 — CID 121382311
tert-butyl 4-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-hydrazinylpentanoyl]amino]benzoate (PubChem CID 121382311) has the molecular formula C21H35N5O4 and a molecular weight of 421.54 g/mol. Its IUPAC name is tert-butyl 4-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-hydrazinylpentanoyl]amino]benzoate.
| Compound Name | tert-butyl 4-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-hydrazinylpentanoyl]amino]benzoate |
|---|---|
| PubChem CID | 121382311 |
| Molecular Formula | C21H35N5O4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | tert-butyl 4-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-hydrazinylpentanoyl]amino]benzoate |
| SMILES | CC(C)[C@H](N)C(=O)N[C@@H](CCCNN)C(=O)Nc1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H35N5O4/c1-13(2)17(22)19(28)26-16(7-6-12-24-23)18(27)25-15-10-8-14(9-11-15)20(29)30-21(3,4)5/h8-11,13,16-17,24H,6-7,12,22-23H2,1-5H3,(H,25,27)(H,26,28)/t16-,17-/m0/s1 |
| InChIKey | YOCRXDMMPXAIHT-IRXDYDNUSA-N |
| XLogP | 1.29 |
| TPSA | 148.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|