C18H29N5O3 — CID 178178374
2-[(2-formamido-3-methylbutanoyl)amino]-5-hydrazinyl-N-(4-methylphenyl)pentanamide (PubChem CID 178178374) has the molecular formula C18H29N5O3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-[(2-formamido-3-methylbutanoyl)amino]-5-hydrazinyl-N-(4-methylphenyl)pentanamide.
| Compound Name | 2-[(2-formamido-3-methylbutanoyl)amino]-5-hydrazinyl-N-(4-methylphenyl)pentanamide |
|---|---|
| PubChem CID | 178178374 |
| Molecular Formula | C18H29N5O3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 2-[(2-formamido-3-methylbutanoyl)amino]-5-hydrazinyl-N-(4-methylphenyl)pentanamide |
| SMILES | Cc1ccc(NC(=O)C(CCCNN)NC(=O)C(NC=O)C(C)C)cc1 |
| InChI | InChI=1S/C18H29N5O3/c1-12(2)16(20-11-24)18(26)23-15(5-4-10-21-19)17(25)22-14-8-6-13(3)7-9-14/h6-9,11-12,15-16,21H,4-5,10,19H2,1-3H3,(H,20,24)(H,22,25)(H,23,26) |
| InChIKey | SRDCKQIRTVCTOV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|