C26H42N8O7 — CID 175176583
2-[[2-[[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetyl]amino]-3-methylbutanoyl]amino]-5-(carbamoylamino)-N-(4-methylphenyl)pentanamide (PubChem CID 175176583) has the molecular formula C26H42N8O7 and a molecular weight of 578.67 g/mol. Its IUPAC name is 2-[[2-[[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetyl]amino]-3-methylbutanoyl]amino]-5-(carbamoylamino)-N-(4-methylphenyl)pentanamide.
| Compound Name | 2-[[2-[[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetyl]amino]-3-methylbutanoyl]amino]-5-(carbamoylamino)-N-(4-methylphenyl)pentanamide |
|---|---|
| PubChem CID | 175176583 |
| Molecular Formula | C26H42N8O7 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.32 |
| IUPAC Name | 2-[[2-[[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetyl]amino]-3-methylbutanoyl]amino]-5-(carbamoylamino)-N-(4-methylphenyl)pentanamide |
| SMILES | Cc1ccc(NC(=O)C(CCCNC(N)=O)NC(=O)C(NC(=O)COCCOCCOCCN=[N+]=[N-])C(C)C)cc1 |
| InChI | InChI=1S/C26H42N8O7/c1-18(2)23(33-22(35)17-41-16-15-40-14-13-39-12-11-30-34-28)25(37)32-21(5-4-10-29-26(27)38)24(36)31-20-8-6-19(3)7-9-20/h6-9,18,21,23H,4-5,10-17H2,1-3H3,(H,31,36)(H,32,37)(H,33,35)(H3,27,29,38) |
| InChIKey | IHEPOBRJZKKDOX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 218.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|