C27H43N9O9 — CID 175146843
[4-[[(2S)-2-[[(2S)-2-[[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetyl]amino]-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methylcarbamic acid (PubChem CID 175146843) has the molecular formula C27H43N9O9 and a molecular weight of 637.69 g/mol. Its IUPAC name is [4-[[(2S)-2-[[(2S)-2-[[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetyl]amino]-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methylcarbamic acid.
| Compound Name | [4-[[(2S)-2-[[(2S)-2-[[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetyl]amino]-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 175146843 |
| Molecular Formula | C27H43N9O9 |
| Molecular Weight | 637.69 g/mol |
| Exact Mass | 637.32 |
| IUPAC Name | [4-[[(2S)-2-[[(2S)-2-[[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetyl]amino]-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methylcarbamic acid |
| SMILES | CC(C)[C@H](NC(=O)COCCOCCOCCN=[N+]=[N-])C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(CNC(=O)O)cc1 |
| InChI | InChI=1S/C27H43N9O9/c1-18(2)23(35-22(37)17-45-15-14-44-13-12-43-11-10-32-36-29)25(39)34-21(4-3-9-30-26(28)40)24(38)33-20-7-5-19(6-8-20)16-31-27(41)42/h5-8,18,21,23,31H,3-4,9-17H2,1-2H3,(H,33,38)(H,34,39)(H,35,37)(H,41,42)(H3,28,30,40)/t21-,23-/m0/s1 |
| InChIKey | QCJCEDZVJFDULG-GMAHTHKFSA-N |
| XLogP | 0.83 |
| TPSA | 268.20 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.69 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|