C19H29N3O3 — CID 163276472
(2S)-6-amino-2-(2,3-dimethylbutanoylamino)-N-(4-formylphenyl)hexanamide (PubChem CID 163276472) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is (2S)-6-amino-2-(2,3-dimethylbutanoylamino)-N-(4-formylphenyl)hexanamide.
| Compound Name | (2S)-6-amino-2-(2,3-dimethylbutanoylamino)-N-(4-formylphenyl)hexanamide |
|---|---|
| PubChem CID | 163276472 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | (2S)-6-amino-2-(2,3-dimethylbutanoylamino)-N-(4-formylphenyl)hexanamide |
| SMILES | CC(C)C(C)C(=O)N[C@@H](CCCCN)C(=O)Nc1ccc(C=O)cc1 |
| InChI | InChI=1S/C19H29N3O3/c1-13(2)14(3)18(24)22-17(6-4-5-11-20)19(25)21-16-9-7-15(12-23)8-10-16/h7-10,12-14,17H,4-6,11,20H2,1-3H3,(H,21,25)(H,22,24)/t14?,17-/m0/s1 |
| InChIKey | XDFRFYUOZZVFGA-JRZJBTRGSA-N |
| XLogP | 2.34 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|